About N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide (PubChem CID 10296648) has the molecular formula C18H9F8N3O
and a molecular weight of 435.27 g/mol. Its IUPAC name is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide |
| PubChem CID | 10296648 |
| Molecular Formula | C18H9F8N3O |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide |
| SMILES | O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H9F8N3O/c19-9-1-6-12(13(20)7-9)16(30)27-10-2-4-11(5-3-10)29-15(18(24,25)26)8-14(28-29)17(21,22)23/h1-8H,(H,27,30) |
| InChIKey | DJXJNXQGYZKPDF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide?
The IUPAC name of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide (CID 10296648) is N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide.
What is the SMILES notation for N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide?
The canonical SMILES for N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide is O=C(Nc1ccc(-n2nc(C(F)(F)F)cc2C(F)(F)F)cc1)c1ccc(F)cc1F.
What is the InChIKey of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide?
The InChIKey is DJXJNXQGYZKPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F8N3O/c19-9-1-6-12(13(20)7-9)16(30)27-10-2-4-11(5-3-10)29-15(18(24,25)26)8-14(28-29)17(21,22)23/h1-8H,(H,27,30).
What are the key properties of N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide?
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide has a molecular weight of 435.27 g/mol, XLogP of 5.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-2,4-difluorobenzamide is sourced from PubChem (CID 10296648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).