C15H29N3O2 — CID 102966587
2-(cyclopropylamino)-5-(3-methoxypiperidin-1-yl)-2-methylpentanamide (PubChem CID 102966587) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 2-(cyclopropylamino)-5-(3-methoxypiperidin-1-yl)-2-methylpentanamide.
| Compound Name | 2-(cyclopropylamino)-5-(3-methoxypiperidin-1-yl)-2-methylpentanamide |
|---|---|
| PubChem CID | 102966587 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2-(cyclopropylamino)-5-(3-methoxypiperidin-1-yl)-2-methylpentanamide |
| SMILES | COC1CCCN(CCCC(C)(NC2CC2)C(N)=O)C1 |
| InChI | InChI=1S/C15H29N3O2/c1-15(14(16)19,17-12-6-7-12)8-4-10-18-9-3-5-13(11-18)20-2/h12-13,17H,3-11H2,1-2H3,(H2,16,19) |
| InChIKey | QNLFWZXIRRSMFD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |