C21H24N8O3 — CID 10296725
4-(benzotriazol-1-yloxy)-1-[4-(2-ethyl-[1,3]oxazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]butan-1-one (PubChem CID 10296725) has the molecular formula C21H24N8O3 and a molecular weight of 436.48 g/mol. Its IUPAC name is 4-(benzotriazol-1-yloxy)-1-[4-(2-ethyl-[1,3]oxazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(benzotriazol-1-yloxy)-1-[4-(2-ethyl-[1,3]oxazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 10296725 |
| Molecular Formula | C21H24N8O3 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-(benzotriazol-1-yloxy)-1-[4-(2-ethyl-[1,3]oxazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]butan-1-one |
| SMILES | CCc1nc2c(N3CCN(C(=O)CCCOn4nnc5ccccc54)CC3)ncnc2o1 |
| InChI | InChI=1S/C21H24N8O3/c1-2-17-24-19-20(22-14-23-21(19)32-17)28-11-9-27(10-12-28)18(30)8-5-13-31-29-16-7-4-3-6-15(16)25-26-29/h3-4,6-7,14H,2,5,8-13H2,1H3 |
| InChIKey | PTJTXFBSADWPDX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|