C30H35N3 — CID 10296843
6-[2-[2-(cyclopropylmethyl)-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide (PubChem CID 10296843) has the molecular formula C30H35N3 and a molecular weight of 437.63 g/mol. Its IUPAC name is 6-[2-[2-(cyclopropylmethyl)-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide.
| Compound Name | 6-[2-[2-(cyclopropylmethyl)-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10296843 |
| Molecular Formula | C30H35N3 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 6-[2-[2-(cyclopropylmethyl)-1-propan-2-yl-3,4-dihydro-1H-isoquinolin-7-yl]cyclopropyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C3CC3c3ccc4c(c3)C(C(C)C)N(CC3CC3)CC4)ccc2c1 |
| InChI | InChI=1S/C30H35N3/c1-18(2)29-28-15-24(8-5-20(28)11-12-33(29)17-19-3-4-19)27-16-26(27)23-9-6-22-14-25(30(31)32)10-7-21(22)13-23/h5-10,13-15,18-19,26-27,29H,3-4,11-12,16-17H2,1-2H3,(H3,31,32) |
| InChIKey | UOGUMPWIYUOFPG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|