3-methoxypiperidine-1-carbonyl chloride

C7H12ClNO2 — CID 102969135

IUPAC3-methoxypiperidine-1-carbonyl chloride
SMILESCOC1CCCN(C(=O)Cl)C1
InChIInChI=1S/C7H12ClNO2/c1-11-6-3-2-4-9(5-6)7(8)10/h6H,2-5H2,1H3
InChIKeyLTBYFXBHQOKWHC-UHFFFAOYSA-N
MW177.63 g/mol
LogP1.46
Rot. Bonds1

About 3-methoxypiperidine-1-carbonyl chloride

3-methoxypiperidine-1-carbonyl chloride (PubChem CID 102969135) has the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. Its IUPAC name is 3-methoxypiperidine-1-carbonyl chloride.

Molecular Properties

Compound Name3-methoxypiperidine-1-carbonyl chloride
PubChem CID102969135
Molecular FormulaC7H12ClNO2
Molecular Weight177.63 g/mol
Exact Mass177.06
IUPAC Name3-methoxypiperidine-1-carbonyl chloride
SMILESCOC1CCCN(C(=O)Cl)C1
InChIInChI=1S/C7H12ClNO2/c1-11-6-3-2-4-9(5-6)7(8)10/h6H,2-5H2,1H3
InChIKeyLTBYFXBHQOKWHC-UHFFFAOYSA-N
XLogP1.46
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500177.63
LogP ≤ 51.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 3-methoxypiperidine-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxypiperidine-1-carbonyl chloride?
The IUPAC name of 3-methoxypiperidine-1-carbonyl chloride (CID 102969135) is 3-methoxypiperidine-1-carbonyl chloride.
What is the SMILES notation for 3-methoxypiperidine-1-carbonyl chloride?
The canonical SMILES for 3-methoxypiperidine-1-carbonyl chloride is COC1CCCN(C(=O)Cl)C1.
What is the InChIKey of 3-methoxypiperidine-1-carbonyl chloride?
The InChIKey is LTBYFXBHQOKWHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO2/c1-11-6-3-2-4-9(5-6)7(8)10/h6H,2-5H2,1H3.
What are the key properties of 3-methoxypiperidine-1-carbonyl chloride?
3-methoxypiperidine-1-carbonyl chloride has a molecular weight of 177.63 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypiperidine-1-carbonyl chloride is sourced from PubChem (CID 102969135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).