About 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine
1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine (PubChem CID 102969676) has the molecular formula C14H17F2N3
and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine |
| PubChem CID | 102969676 |
| Molecular Formula | C14H17F2N3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine |
| SMILES | CC(C)C(N)c1cncn1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C14H17F2N3/c1-9(2)14(17)13-6-18-8-19(13)7-10-3-4-11(15)5-12(10)16/h3-6,8-9,14H,7,17H2,1-2H3 |
| InChIKey | SJSWMCNYXYDYBN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine?
The IUPAC name of 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine (CID 102969676) is 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine.
What is the SMILES notation for 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine?
The canonical SMILES for 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine is CC(C)C(N)c1cncn1Cc1ccc(F)cc1F.
What is the InChIKey of 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine?
The InChIKey is SJSWMCNYXYDYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2N3/c1-9(2)14(17)13-6-18-8-19(13)7-10-3-4-11(15)5-12(10)16/h3-6,8-9,14H,7,17H2,1-2H3.
What are the key properties of 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine?
1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine has a molecular weight of 265.31 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2,4-difluorophenyl)methyl]imidazol-4-yl]-2-methylpropan-1-amine is sourced from PubChem (CID 102969676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).