About (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine
(1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine (PubChem CID 102970397) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine |
| PubChem CID | 102970397 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine |
| SMILES | CC[C@H](N)c1nc2c([nH]1)COC2C |
| InChI | InChI=1S/C9H15N3O/c1-3-6(10)9-11-7-4-13-5(2)8(7)12-9/h5-6H,3-4,10H2,1-2H3,(H,11,12)/t5?,6-/m0/s1 |
| InChIKey | SJNJLHJZAPYEBU-GDVGLLTNSA-N |
| XLogP | 1.41 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine?
The IUPAC name of (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine (CID 102970397) is (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine.
What is the SMILES notation for (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine?
The canonical SMILES for (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine is CC[C@H](N)c1nc2c([nH]1)COC2C.
What is the InChIKey of (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine?
The InChIKey is SJNJLHJZAPYEBU-GDVGLLTNSA-N. The full InChI is InChI=1S/C9H15N3O/c1-3-6(10)9-11-7-4-13-5(2)8(7)12-9/h5-6H,3-4,10H2,1-2H3,(H,11,12)/t5?,6-/m0/s1.
What are the key properties of (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine?
(1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine has a molecular weight of 181.24 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-methyl-4,6-dihydro-1H-furo[3,4-d]imidazol-2-yl)propan-1-amine is sourced from PubChem (CID 102970397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).