About methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate
methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate (PubChem CID 10297155) has the molecular formula C28H30N2O3
and a molecular weight of 442.56 g/mol. Its IUPAC name is methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate.
Molecular Properties
| Compound Name | methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate |
| PubChem CID | 10297155 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1ccc2nc(-c3ccccc3)n(-c3ccc(C)c(C)c3)c2c1 |
| InChI | InChI=1S/C28H30N2O3/c1-20-13-14-23(18-21(20)2)30-26-19-24(33-17-9-5-8-12-27(31)32-3)15-16-25(26)29-28(30)22-10-6-4-7-11-22/h4,6-7,10-11,13-16,18-19H,5,8-9,12,17H2,1-3H3 |
| InChIKey | RFNXOSMCFKSBMU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate?
The IUPAC name of methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate (CID 10297155) is methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate.
What is the SMILES notation for methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate?
The canonical SMILES for methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate is COC(=O)CCCCCOc1ccc2nc(-c3ccccc3)n(-c3ccc(C)c(C)c3)c2c1.
What is the InChIKey of methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate?
The InChIKey is RFNXOSMCFKSBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H30N2O3/c1-20-13-14-23(18-21(20)2)30-26-19-24(33-17-9-5-8-12-27(31)32-3)15-16-25(26)29-28(30)22-10-6-4-7-11-22/h4,6-7,10-11,13-16,18-19H,5,8-9,12,17H2,1-3H3.
What are the key properties of methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate?
methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate has a molecular weight of 442.56 g/mol, XLogP of 6.42, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[3-(3,4-dimethylphenyl)-2-phenylbenzimidazol-5-yl]oxyhexanoate is sourced from PubChem (CID 10297155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).