C26H34O4S — CID 10297170
6-(5-carboxy-5-phenylhexyl)sulfanyl-2-methyl-2-phenylhexanoic acid (PubChem CID 10297170) has the molecular formula C26H34O4S and a molecular weight of 442.62 g/mol. Its IUPAC name is 6-(5-carboxy-5-phenylhexyl)sulfanyl-2-methyl-2-phenylhexanoic acid.
| Compound Name | 6-(5-carboxy-5-phenylhexyl)sulfanyl-2-methyl-2-phenylhexanoic acid |
|---|---|
| PubChem CID | 10297170 |
| Molecular Formula | C26H34O4S |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 6-(5-carboxy-5-phenylhexyl)sulfanyl-2-methyl-2-phenylhexanoic acid |
| SMILES | CC(CCCCSCCCCC(C)(C(=O)O)c1ccccc1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H34O4S/c1-25(23(27)28,21-13-5-3-6-14-21)17-9-11-19-31-20-12-10-18-26(2,24(29)30)22-15-7-4-8-16-22/h3-8,13-16H,9-12,17-20H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | CQMGKZDPSUYHTH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|