C10H13N3O3 — CID 102972424
ethyl 2-(2-amino-2-oxoethyl)-4-methylpyrimidine-5-carboxylate (PubChem CID 102972424) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is ethyl 2-(2-amino-2-oxoethyl)-4-methylpyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(2-amino-2-oxoethyl)-4-methylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 102972424 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | ethyl 2-(2-amino-2-oxoethyl)-4-methylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CC(N)=O)nc1C |
| InChI | InChI=1S/C10H13N3O3/c1-3-16-10(15)7-5-12-9(4-8(11)14)13-6(7)2/h5H,3-4H2,1-2H3,(H2,11,14) |
| InChIKey | PVWZIPUBGDWBOY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |