C19H13F6N3O3 — CID 10297307
N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]pyridine-4-carboxamide (PubChem CID 10297307) has the molecular formula C19H13F6N3O3 and a molecular weight of 445.32 g/mol. Its IUPAC name is N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]pyridine-4-carboxamide.
| Compound Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10297307 |
| Molecular Formula | C19H13F6N3O3 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]pyridine-4-carboxamide |
| SMILES | Cc1onc(NC(=O)c2ccncc2)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H13F6N3O3/c1-10-14(15(28-31-10)27-16(29)12-6-8-26-9-7-12)11-2-4-13(5-3-11)17(30,18(20,21)22)19(23,24)25/h2-9,30H,1H3,(H,27,28,29) |
| InChIKey | VIRUCZBSURSOOJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |