C26H27N3O4 — CID 10297331
(1R)-2-[2-[4-[2-(phenylmethoxymethyl)-1,3-oxazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol (PubChem CID 10297331) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (1R)-2-[2-[4-[2-(phenylmethoxymethyl)-1,3-oxazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol.
| Compound Name | (1R)-2-[2-[4-[2-(phenylmethoxymethyl)-1,3-oxazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 10297331 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (1R)-2-[2-[4-[2-(phenylmethoxymethyl)-1,3-oxazol-4-yl]phenoxy]ethylamino]-1-pyridin-3-ylethanol |
| SMILES | O[C@@H](CNCCOc1ccc(-c2coc(COCc3ccccc3)n2)cc1)c1cccnc1 |
| InChI | InChI=1S/C26H27N3O4/c30-25(22-7-4-12-27-15-22)16-28-13-14-32-23-10-8-21(9-11-23)24-18-33-26(29-24)19-31-17-20-5-2-1-3-6-20/h1-12,15,18,25,28,30H,13-14,16-17,19H2/t25-/m0/s1 |
| InChIKey | CUDRJWAWTWOKFG-VWLOTQADSA-N |
| XLogP | 4.16 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|