4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid

C11H16N4O2 — CID 102974209

IUPAC4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid
SMILESO=C(O)c1cncnc1CN1CCCNCC1
InChIInChI=1S/C11H16N4O2/c16-11(17)9-6-13-8-14-10(9)7-15-4-1-2-12-3-5-15/h6,8,12H,1-5,7H2,(H,16,17)
InChIKeyOGONGMJIGYJEDV-UHFFFAOYSA-N
MW236.27 g/mol
LogP-0.03
Rot. Bonds3

About 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid

4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid (PubChem CID 102974209) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid.

Molecular Properties

Compound Name4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid
PubChem CID102974209
Molecular FormulaC11H16N4O2
Molecular Weight236.27 g/mol
Exact Mass236.13
IUPAC Name4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid
SMILESO=C(O)c1cncnc1CN1CCCNCC1
InChIInChI=1S/C11H16N4O2/c16-11(17)9-6-13-8-14-10(9)7-15-4-1-2-12-3-5-15/h6,8,12H,1-5,7H2,(H,16,17)
InChIKeyOGONGMJIGYJEDV-UHFFFAOYSA-N
XLogP-0.03
TPSA78.35 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 5-0.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid?
The IUPAC name of 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid (CID 102974209) is 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid.
What is the SMILES notation for 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid?
The canonical SMILES for 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid is O=C(O)c1cncnc1CN1CCCNCC1.
What is the InChIKey of 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid?
The InChIKey is OGONGMJIGYJEDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2/c16-11(17)9-6-13-8-14-10(9)7-15-4-1-2-12-3-5-15/h6,8,12H,1-5,7H2,(H,16,17).
What are the key properties of 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid?
4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid has a molecular weight of 236.27 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-diazepan-1-ylmethyl)pyrimidine-5-carboxylic acid is sourced from PubChem (CID 102974209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).