About 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol
3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol (PubChem CID 102975913) has the molecular formula C7H8ClF2N3O
and a molecular weight of 223.61 g/mol. Its IUPAC name is 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol |
| PubChem CID | 102975913 |
| Molecular Formula | C7H8ClF2N3O |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol |
| SMILES | OC(CNc1ncncc1Cl)C(F)F |
| InChI | InChI=1S/C7H8ClF2N3O/c8-4-1-11-3-13-7(4)12-2-5(14)6(9)10/h1,3,5-6,14H,2H2,(H,11,12,13) |
| InChIKey | YIORLZXPKGSSMN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol?
The IUPAC name of 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol (CID 102975913) is 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol is OC(CNc1ncncc1Cl)C(F)F.
What is the InChIKey of 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol?
The InChIKey is YIORLZXPKGSSMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClF2N3O/c8-4-1-11-3-13-7(4)12-2-5(14)6(9)10/h1,3,5-6,14H,2H2,(H,11,12,13).
What are the key properties of 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol?
3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol has a molecular weight of 223.61 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-chloropyrimidin-4-yl)amino]-1,1-difluoropropan-2-ol is sourced from PubChem (CID 102975913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).