C13H19ClN2OS — CID 102976460
1-[2-[1-(5-chlorothiophen-3-yl)ethylamino]propyl]pyrrolidin-2-one (PubChem CID 102976460) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is 1-[2-[1-(5-chlorothiophen-3-yl)ethylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[1-(5-chlorothiophen-3-yl)ethylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102976460 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-[2-[1-(5-chlorothiophen-3-yl)ethylamino]propyl]pyrrolidin-2-one |
| SMILES | CC(CN1CCCC1=O)NC(C)c1csc(Cl)c1 |
| InChI | InChI=1S/C13H19ClN2OS/c1-9(7-16-5-3-4-13(16)17)15-10(2)11-6-12(14)18-8-11/h6,8-10,15H,3-5,7H2,1-2H3 |
| InChIKey | PFXSXHJWXCWENV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |