C13H20ClNS2 — CID 102976624
N-[1-(5-chlorothiophen-3-yl)ethyl]-2-methylsulfanylcyclohexan-1-amine (PubChem CID 102976624) has the molecular formula C13H20ClNS2 and a molecular weight of 289.90 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-3-yl)ethyl]-2-methylsulfanylcyclohexan-1-amine.
| Compound Name | N-[1-(5-chlorothiophen-3-yl)ethyl]-2-methylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102976624 |
| Molecular Formula | C13H20ClNS2 |
| Molecular Weight | 289.90 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[1-(5-chlorothiophen-3-yl)ethyl]-2-methylsulfanylcyclohexan-1-amine |
| SMILES | CSC1CCCCC1NC(C)c1csc(Cl)c1 |
| InChI | InChI=1S/C13H20ClNS2/c1-9(10-7-13(14)17-8-10)15-11-5-3-4-6-12(11)16-2/h7-9,11-12,15H,3-6H2,1-2H3 |
| InChIKey | MAJAUTRWIUCYEB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.90 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |