C14H17ClN4OS — CID 102976956
2-[4-[1-(5-chlorothiophen-3-yl)ethylamino]pyrazol-1-yl]-N-cyclopropylacetamide (PubChem CID 102976956) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is 2-[4-[1-(5-chlorothiophen-3-yl)ethylamino]pyrazol-1-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[1-(5-chlorothiophen-3-yl)ethylamino]pyrazol-1-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 102976956 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[4-[1-(5-chlorothiophen-3-yl)ethylamino]pyrazol-1-yl]-N-cyclopropylacetamide |
| SMILES | CC(Nc1cnn(CC(=O)NC2CC2)c1)c1csc(Cl)c1 |
| InChI | InChI=1S/C14H17ClN4OS/c1-9(10-4-13(15)21-8-10)17-12-5-16-19(6-12)7-14(20)18-11-2-3-11/h4-6,8-9,11,17H,2-3,7H2,1H3,(H,18,20) |
| InChIKey | KWZIZINZSBLIPE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |