About N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine
N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine (PubChem CID 102976958) has the molecular formula C14H15ClN4S
and a molecular weight of 306.82 g/mol. Its IUPAC name is N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
| PubChem CID | 102976958 |
| Molecular Formula | C14H15ClN4S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine |
| SMILES | Cc1nn(C)c2ncc(NC(C)c3csc(Cl)c3)cc12 |
| InChI | InChI=1S/C14H15ClN4S/c1-8(10-4-13(15)20-7-10)17-11-5-12-9(2)18-19(3)14(12)16-6-11/h4-8,17H,1-3H3 |
| InChIKey | RPNQPWQDGOQDTJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine?
The IUPAC name of N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine (CID 102976958) is N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine.
What is the SMILES notation for N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine?
The canonical SMILES for N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine is Cc1nn(C)c2ncc(NC(C)c3csc(Cl)c3)cc12.
What is the InChIKey of N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine?
The InChIKey is RPNQPWQDGOQDTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN4S/c1-8(10-4-13(15)20-7-10)17-11-5-12-9(2)18-19(3)14(12)16-6-11/h4-8,17H,1-3H3.
What are the key properties of N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine?
N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine has a molecular weight of 306.82 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-chlorothiophen-3-yl)ethyl]-1,3-dimethylpyrazolo[5,4-b]pyridin-5-amine is sourced from PubChem (CID 102976958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).