C13H17N3O3 — CID 102977008
2-amino-N-[(2,2-dimethylcyclopropyl)methyl]-5-nitrobenzamide (PubChem CID 102977008) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-amino-N-[(2,2-dimethylcyclopropyl)methyl]-5-nitrobenzamide.
| Compound Name | 2-amino-N-[(2,2-dimethylcyclopropyl)methyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 102977008 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-amino-N-[(2,2-dimethylcyclopropyl)methyl]-5-nitrobenzamide |
| SMILES | CC1(C)CC1CNC(=O)c1cc([N+](=O)[O-])ccc1N |
| InChI | InChI=1S/C13H17N3O3/c1-13(2)6-8(13)7-15-12(17)10-5-9(16(18)19)3-4-11(10)14/h3-5,8H,6-7,14H2,1-2H3,(H,15,17) |
| InChIKey | DAIWTQHLDQVIQQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|