C14H19Br2N3O — CID 102977405
2-[(3R)-3-aminopiperidin-1-yl]-N-(2,6-dibromo-4-methylphenyl)acetamide (PubChem CID 102977405) has the molecular formula C14H19Br2N3O and a molecular weight of 405.13 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-N-(2,6-dibromo-4-methylphenyl)acetamide.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-N-(2,6-dibromo-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 102977405 |
| Molecular Formula | C14H19Br2N3O |
| Molecular Weight | 405.13 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-N-(2,6-dibromo-4-methylphenyl)acetamide |
| SMILES | Cc1cc(Br)c(NC(=O)CN2CCC[C@@H](N)C2)c(Br)c1 |
| InChI | InChI=1S/C14H19Br2N3O/c1-9-5-11(15)14(12(16)6-9)18-13(20)8-19-4-2-3-10(17)7-19/h5-6,10H,2-4,7-8,17H2,1H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | KMMGFZMLAZMLKQ-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.13 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |