C10H14ClF2NOS — CID 102978085
1-(5-chlorothiophen-2-yl)-N-[2-(2,2-difluoroethoxy)ethyl]ethanamine (PubChem CID 102978085) has the molecular formula C10H14ClF2NOS and a molecular weight of 269.74 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-[2-(2,2-difluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-[2-(2,2-difluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 102978085 |
| Molecular Formula | C10H14ClF2NOS |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-[2-(2,2-difluoroethoxy)ethyl]ethanamine |
| SMILES | CC(NCCOCC(F)F)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14ClF2NOS/c1-7(8-2-3-9(11)16-8)14-4-5-15-6-10(12)13/h2-3,7,10,14H,4-6H2,1H3 |
| InChIKey | XUWUFNAYTBDSPH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|