About tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate
tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate (PubChem CID 102978141) has the molecular formula C16H30F2N2O3
and a molecular weight of 336.42 g/mol. Its IUPAC name is tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate |
| PubChem CID | 102978141 |
| Molecular Formula | C16H30F2N2O3 |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCC1NCCOCC(F)F |
| InChI | InChI=1S/C16H30F2N2O3/c1-16(2,3)23-15(21)20-10-12-6-4-5-7-13(12)19-8-9-22-11-14(17)18/h12-14,19H,4-11H2,1-3H3,(H,20,21) |
| InChIKey | YKHABMFLJGGZTO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate (CID 102978141) is tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate is CC(C)(C)OC(=O)NCC1CCCCC1NCCOCC(F)F.
What is the InChIKey of tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate?
The InChIKey is YKHABMFLJGGZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30F2N2O3/c1-16(2,3)23-15(21)20-10-12-6-4-5-7-13(12)19-8-9-22-11-14(17)18/h12-14,19H,4-11H2,1-3H3,(H,20,21).
What are the key properties of tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate?
tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate has a molecular weight of 336.42 g/mol, XLogP of 2.94, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[2-[2-(2,2-difluoroethoxy)ethylamino]cyclohexyl]methyl]carbamate is sourced from PubChem (CID 102978141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).