C28H27N3O3 — CID 10297830
ethyl 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoate (PubChem CID 10297830) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is ethyl 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoate.
| Compound Name | ethyl 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoate |
|---|---|
| PubChem CID | 10297830 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | ethyl 5-[3-[3-(naphthalen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]indol-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCCn1cc(-c2nc(Cc3ccc4ccccc4c3)no2)c2ccccc21 |
| InChI | InChI=1S/C28H27N3O3/c1-2-33-27(32)13-7-8-16-31-19-24(23-11-5-6-12-25(23)31)28-29-26(30-34-28)18-20-14-15-21-9-3-4-10-22(21)17-20/h3-6,9-12,14-15,17,19H,2,7-8,13,16,18H2,1H3 |
| InChIKey | JPDLIXGMALSOMP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|