About 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one
1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 102978512) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one.
Molecular Properties
| Compound Name | 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one |
| PubChem CID | 102978512 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | N[C@@H]1CCCN(C(=O)CCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H15F3N2O/c10-9(11,12)4-3-8(15)14-5-1-2-7(13)6-14/h7H,1-6,13H2/t7-/m1/s1 |
| InChIKey | GPYQCFFYXYYNET-SSDOTTSWSA-N |
| XLogP | 1.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one?
The IUPAC name of 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one (CID 102978512) is 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one.
What is the SMILES notation for 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one?
The canonical SMILES for 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one is N[C@@H]1CCCN(C(=O)CCC(F)(F)F)C1.
What is the InChIKey of 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one?
The InChIKey is GPYQCFFYXYYNET-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H15F3N2O/c10-9(11,12)4-3-8(15)14-5-1-2-7(13)6-14/h7H,1-6,13H2/t7-/m1/s1.
What are the key properties of 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one?
1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one has a molecular weight of 224.23 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3-aminopiperidin-1-yl]-4,4,4-trifluorobutan-1-one is sourced from PubChem (CID 102978512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).