C13H16INO4 — CID 102978661
(3-hydroxy-4-iodophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone (PubChem CID 102978661) has the molecular formula C13H16INO4 and a molecular weight of 377.18 g/mol. Its IUPAC name is (3-hydroxy-4-iodophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone.
| Compound Name | (3-hydroxy-4-iodophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 102978661 |
| Molecular Formula | C13H16INO4 |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | (3-hydroxy-4-iodophenyl)-[2-(hydroxymethyl)-6-methylmorpholin-4-yl]methanone |
| SMILES | CC1CN(C(=O)c2ccc(I)c(O)c2)CC(CO)O1 |
| InChI | InChI=1S/C13H16INO4/c1-8-5-15(6-10(7-16)19-8)13(18)9-2-3-11(14)12(17)4-9/h2-4,8,10,16-17H,5-7H2,1H3 |
| InChIKey | IECDMAWXMIPNGW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|