C12H18BrNO — CID 102980133
(2-bromo-6-pentan-2-yloxyphenyl)methanamine (PubChem CID 102980133) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is (2-bromo-6-pentan-2-yloxyphenyl)methanamine.
| Compound Name | (2-bromo-6-pentan-2-yloxyphenyl)methanamine |
|---|---|
| PubChem CID | 102980133 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | (2-bromo-6-pentan-2-yloxyphenyl)methanamine |
| SMILES | CCCC(C)Oc1cccc(Br)c1CN |
| InChI | InChI=1S/C12H18BrNO/c1-3-5-9(2)15-12-7-4-6-11(13)10(12)8-14/h4,6-7,9H,3,5,8,14H2,1-2H3 |
| InChIKey | BBHUYNUPHYTMRH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |