C32H33N3 — CID 10298221
6-[2-(1-benzyl-4-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)cyclopropyl]naphthalene-2-carboximidamide (PubChem CID 10298221) has the molecular formula C32H33N3 and a molecular weight of 459.64 g/mol. Its IUPAC name is 6-[2-(1-benzyl-4-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)cyclopropyl]naphthalene-2-carboximidamide.
| Compound Name | 6-[2-(1-benzyl-4-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)cyclopropyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10298221 |
| Molecular Formula | C32H33N3 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 6-[2-(1-benzyl-4-ethyl-1,2,3,4-tetrahydroisoquinolin-6-yl)cyclopropyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(C3CC3c3ccc4c(c3)C(CC)CNC4Cc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C32H33N3/c1-2-21-19-35-31(14-20-6-4-3-5-7-20)27-13-12-25(17-28(21)27)30-18-29(30)24-10-8-23-16-26(32(33)34)11-9-22(23)15-24/h3-13,15-17,21,29-31,35H,2,14,18-19H2,1H3,(H3,33,34) |
| InChIKey | WWQPWTPVFFGEAD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|