About pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate
pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 102983089) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate.
Molecular Properties
| Compound Name | pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate |
| PubChem CID | 102983089 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | CCCC(C)OC(=O)c1cc(N)cn1C |
| InChI | InChI=1S/C11H18N2O2/c1-4-5-8(2)15-11(14)10-6-9(12)7-13(10)3/h6-8H,4-5,12H2,1-3H3 |
| InChIKey | AQXBOBCIIMHQNO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate?
The IUPAC name of pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate (CID 102983089) is pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate.
What is the SMILES notation for pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate?
The canonical SMILES for pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate is CCCC(C)OC(=O)c1cc(N)cn1C.
What is the InChIKey of pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate?
The InChIKey is AQXBOBCIIMHQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-4-5-8(2)15-11(14)10-6-9(12)7-13(10)3/h6-8H,4-5,12H2,1-3H3.
What are the key properties of pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate?
pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate has a molecular weight of 210.28 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 4-amino-1-methylpyrrole-2-carboxylate is sourced from PubChem (CID 102983089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).