C17H13Cl3F2N6O — CID 10298327
N-[2,2-dichloro-1-[(Z)-[[(6-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]-3,5-difluorobenzamide (PubChem CID 10298327) has the molecular formula C17H13Cl3F2N6O and a molecular weight of 461.69 g/mol. Its IUPAC name is N-[2,2-dichloro-1-[(Z)-[[(6-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]-3,5-difluorobenzamide.
| Compound Name | N-[2,2-dichloro-1-[(Z)-[[(6-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 10298327 |
| Molecular Formula | C17H13Cl3F2N6O |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | N-[2,2-dichloro-1-[(Z)-[[(6-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]-3,5-difluorobenzamide |
| SMILES | CC(Cl)(Cl)C(/N=C(\NC#N)Nc1ccc(Cl)nc1)NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H13Cl3F2N6O/c1-17(19,20)15(27-14(29)9-4-10(21)6-11(22)5-9)28-16(25-8-23)26-12-2-3-13(18)24-7-12/h2-7,15H,1H3,(H,27,29)(H2,25,26,28) |
| InChIKey | GGYHIXVMGNKTHP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|