C24H17ClFN5O2 — CID 10298332
8-[(2-chloropyridine-3-carbonyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide (PubChem CID 10298332) has the molecular formula C24H17ClFN5O2 and a molecular weight of 461.88 g/mol. Its IUPAC name is 8-[(2-chloropyridine-3-carbonyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(2-chloropyridine-3-carbonyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10298332 |
| Molecular Formula | C24H17ClFN5O2 |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 8-[(2-chloropyridine-3-carbonyl)amino]-1-(4-fluorophenyl)-4,5-dihydrobenzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(F)cc2)c2c1CCc1ccc(NC(=O)c3cccnc3Cl)cc1-2 |
| InChI | InChI=1S/C24H17ClFN5O2/c25-22-18(2-1-11-28-22)24(33)29-15-7-3-13-4-10-17-20(23(27)32)30-31(21(17)19(13)12-15)16-8-5-14(26)6-9-16/h1-3,5-9,11-12H,4,10H2,(H2,27,32)(H,29,33) |
| InChIKey | SYFDUZQHFKRFGW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|