C14H18ClN3O2 — CID 102985314
N-[2-[(3R)-3-aminopiperidin-1-yl]acetyl]-4-chlorobenzamide (PubChem CID 102985314) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is N-[2-[(3R)-3-aminopiperidin-1-yl]acetyl]-4-chlorobenzamide.
| Compound Name | N-[2-[(3R)-3-aminopiperidin-1-yl]acetyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 102985314 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[2-[(3R)-3-aminopiperidin-1-yl]acetyl]-4-chlorobenzamide |
| SMILES | N[C@@H]1CCCN(CC(=O)NC(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H18ClN3O2/c15-11-5-3-10(4-6-11)14(20)17-13(19)9-18-7-1-2-12(16)8-18/h3-6,12H,1-2,7-9,16H2,(H,17,19,20)/t12-/m1/s1 |
| InChIKey | UADVMSPULXAKBM-GFCCVEGCSA-N |
| XLogP | 1.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |