C10H8BrClN4 — CID 102985399
3-N-(4-bromo-2-chlorophenyl)pyrazine-2,3-diamine (PubChem CID 102985399) has the molecular formula C10H8BrClN4 and a molecular weight of 299.56 g/mol. Its IUPAC name is 3-N-(4-bromo-2-chlorophenyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(4-bromo-2-chlorophenyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 102985399 |
| Molecular Formula | C10H8BrClN4 |
| Molecular Weight | 299.56 g/mol |
| Exact Mass | 297.96 |
| IUPAC Name | 3-N-(4-bromo-2-chlorophenyl)pyrazine-2,3-diamine |
| SMILES | Nc1nccnc1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C10H8BrClN4/c11-6-1-2-8(7(12)5-6)16-10-9(13)14-3-4-15-10/h1-5H,(H2,13,14)(H,15,16) |
| InChIKey | WGVBUMQGGXTKQK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |