C12H16N4 — CID 102985418
3-N-methyl-3-N-propylquinoxaline-2,3-diamine (PubChem CID 102985418) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-N-methyl-3-N-propylquinoxaline-2,3-diamine.
| Compound Name | 3-N-methyl-3-N-propylquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102985418 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-N-methyl-3-N-propylquinoxaline-2,3-diamine |
| SMILES | CCCN(C)c1nc2ccccc2nc1N |
| InChI | InChI=1S/C12H16N4/c1-3-8-16(2)12-11(13)14-9-6-4-5-7-10(9)15-12/h4-7H,3,8H2,1-2H3,(H2,13,14) |
| InChIKey | RAELXKUHGISBIV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |