C13H18N4O — CID 102987287
3-N-(2-ethoxypropyl)quinoxaline-2,3-diamine (PubChem CID 102987287) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-N-(2-ethoxypropyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(2-ethoxypropyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102987287 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-N-(2-ethoxypropyl)quinoxaline-2,3-diamine |
| SMILES | CCOC(C)CNc1nc2ccccc2nc1N |
| InChI | InChI=1S/C13H18N4O/c1-3-18-9(2)8-15-13-12(14)16-10-6-4-5-7-11(10)17-13/h4-7,9H,3,8H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | ZDLHAFUSKWPYDU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |