About 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine (PubChem CID 102988738) has the molecular formula C11H10N6S
and a molecular weight of 258.31 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine.
Molecular Properties
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine |
| PubChem CID | 102988738 |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine |
| SMILES | Cn1cnnc1Sc1nc2ccccc2nc1N |
| InChI | InChI=1S/C11H10N6S/c1-17-6-13-16-11(17)18-10-9(12)14-7-4-2-3-5-8(7)15-10/h2-6H,1H3,(H2,12,14) |
| InChIKey | RLXOBWULDSJZSR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine?
The IUPAC name of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine (CID 102988738) is 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine.
What is the SMILES notation for 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine?
The canonical SMILES for 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine is Cn1cnnc1Sc1nc2ccccc2nc1N.
What is the InChIKey of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine?
The InChIKey is RLXOBWULDSJZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N6S/c1-17-6-13-16-11(17)18-10-9(12)14-7-4-2-3-5-8(7)15-10/h2-6H,1H3,(H2,12,14).
What are the key properties of 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine?
3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine has a molecular weight of 258.31 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoxalin-2-amine is sourced from PubChem (CID 102988738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).