C7H11N3OS — CID 102989025
2-(3-aminopyrazin-2-yl)sulfanylpropan-1-ol (PubChem CID 102989025) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanylpropan-1-ol.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 102989025 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanylpropan-1-ol |
| SMILES | CC(CO)Sc1nccnc1N |
| InChI | InChI=1S/C7H11N3OS/c1-5(4-11)12-7-6(8)9-2-3-10-7/h2-3,5,11H,4H2,1H3,(H2,8,9) |
| InChIKey | ZIFGSVCJEQJXKJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |