C8H13ClN4O — CID 102989508
4-chloro-6-pentan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 102989508) has the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-chloro-6-pentan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-pentan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 102989508 |
| Molecular Formula | C8H13ClN4O |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 4-chloro-6-pentan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | CCCC(C)Oc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C8H13ClN4O/c1-3-4-5(2)14-8-12-6(9)11-7(10)13-8/h5H,3-4H2,1-2H3,(H2,10,11,12,13) |
| InChIKey | WIHOAZGDQGOAEN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |