C22H21ClF3NOS2 — CID 10298994
N,N-dimethyl-2-[[16-(trifluoromethyl)-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl]methoxy]ethanamine;hydrochloride (PubChem CID 10298994) has the molecular formula C22H21ClF3NOS2 and a molecular weight of 472.00 g/mol. Its IUPAC name is N,N-dimethyl-2-[[16-(trifluoromethyl)-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl]methoxy]ethanamine;hydrochloride.
| Compound Name | N,N-dimethyl-2-[[16-(trifluoromethyl)-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl]methoxy]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 10298994 |
| Molecular Formula | C22H21ClF3NOS2 |
| Molecular Weight | 472.00 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N,N-dimethyl-2-[[16-(trifluoromethyl)-3,13-dithiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl]methoxy]ethanamine;hydrochloride |
| SMILES | CN(C)CCOCc1cc2c(s1)-c1ccc(C(F)(F)F)cc1Sc1ccccc1-2.Cl |
| InChI | InChI=1S/C22H20F3NOS2.ClH/c1-26(2)9-10-27-13-15-12-18-16-5-3-4-6-19(16)29-20-11-14(22(23,24)25)7-8-17(20)21(18)28-15;/h3-8,11-12H,9-10,13H2,1-2H3;1H |
| InChIKey | GIUDILHULCTFCL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.00 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|