C19H22F6N2O5 — CID 10299006
5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoic acid (PubChem CID 10299006) has the molecular formula C19H22F6N2O5 and a molecular weight of 472.38 g/mol. Its IUPAC name is 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoic acid.
| Compound Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 10299006 |
| Molecular Formula | C19H22F6N2O5 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-N-(morpholine-4-carbonyl)anilino]pentanoic acid |
| SMILES | O=C(O)CCCCN(C(=O)N1CCOCC1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F6N2O5/c20-18(21,22)17(31,19(23,24)25)13-4-6-14(7-5-13)27(8-2-1-3-15(28)29)16(30)26-9-11-32-12-10-26/h4-7,31H,1-3,8-12H2,(H,28,29) |
| InChIKey | NJHMKFSATBCLQS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|