C15H21FO — CID 102990439
2-(3,5-dimethylcyclohexyl)oxy-4-fluoro-1-methylbenzene (PubChem CID 102990439) has the molecular formula C15H21FO and a molecular weight of 236.33 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)oxy-4-fluoro-1-methylbenzene.
| Compound Name | 2-(3,5-dimethylcyclohexyl)oxy-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 102990439 |
| Molecular Formula | C15H21FO |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)oxy-4-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(F)cc1OC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H21FO/c1-10-6-11(2)8-14(7-10)17-15-9-13(16)5-4-12(15)3/h4-5,9-11,14H,6-8H2,1-3H3 |
| InChIKey | YSWMUXYWSWTKMW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |