About 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one
1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 102990678) has the molecular formula C14H15FO2
and a molecular weight of 234.27 g/mol. Its IUPAC name is 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one |
| PubChem CID | 102990678 |
| Molecular Formula | C14H15FO2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | Cc1ccc(F)c2cc(C(=O)C(C)(C)C)oc12 |
| InChI | InChI=1S/C14H15FO2/c1-8-5-6-10(15)9-7-11(17-12(8)9)13(16)14(2,3)4/h5-7H,1-4H3 |
| InChIKey | GUHGOOZXFLLUMK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one?
The IUPAC name of 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one (CID 102990678) is 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one is Cc1ccc(F)c2cc(C(=O)C(C)(C)C)oc12.
What is the InChIKey of 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one?
The InChIKey is GUHGOOZXFLLUMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FO2/c1-8-5-6-10(15)9-7-11(17-12(8)9)13(16)14(2,3)4/h5-7H,1-4H3.
What are the key properties of 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one?
1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one has a molecular weight of 234.27 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-7-methyl-1-benzofuran-2-yl)-2,2-dimethylpropan-1-one is sourced from PubChem (CID 102990678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).