About 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine
1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 102990740) has the molecular formula C12H14FNO
and a molecular weight of 207.25 g/mol. Its IUPAC name is 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine |
| PubChem CID | 102990740 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CNCc1oc2c(C)ccc(F)c2c1C |
| InChI | InChI=1S/C12H14FNO/c1-7-4-5-9(13)11-8(2)10(6-14-3)15-12(7)11/h4-5,14H,6H2,1-3H3 |
| InChIKey | FFEJDMOARJOTDR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine?
The IUPAC name of 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine (CID 102990740) is 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine.
What is the SMILES notation for 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine?
The canonical SMILES for 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine is CNCc1oc2c(C)ccc(F)c2c1C.
What is the InChIKey of 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine?
The InChIKey is FFEJDMOARJOTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO/c1-7-4-5-9(13)11-8(2)10(6-14-3)15-12(7)11/h4-5,14H,6H2,1-3H3.
What are the key properties of 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine?
1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine has a molecular weight of 207.25 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-3,7-dimethyl-1-benzofuran-2-yl)-N-methylmethanamine is sourced from PubChem (CID 102990740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).