C28H26N8 — CID 10299153
1,8,11,28,32,33,34,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6,9,12,14,16,18,20,22,24,26,29-tridecaene (PubChem CID 10299153) has the molecular formula C28H26N8 and a molecular weight of 474.57 g/mol. Its IUPAC name is 1,8,11,28,32,33,34,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6,9,12,14,16,18,20,22,24,26,29-tridecaene.
| Compound Name | 1,8,11,28,32,33,34,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6,9,12,14,16,18,20,22,24,26,29-tridecaene |
|---|---|
| PubChem CID | 10299153 |
| Molecular Formula | C28H26N8 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 1,8,11,28,32,33,34,36-octazaheptacyclo[26.2.1.13,6.18,11.113,16.118,21.123,26]hexatriaconta-2,4,6,9,12,14,16,18,20,22,24,26,29-tridecaene |
| SMILES | C1=CN2/C=c3/cc/c([nH]3)=C\N3C=CN(/C=c4\cc/c([nH]4)=C/c4ccc([nH]4)/C=c4\cc/c([nH]4)=C/N1C2)C3 |
| InChI | InChI=1S/C28H26N8/c1-2-22-14-24-4-6-26(31-24)16-34-10-12-36(20-34)18-28-8-7-27(32-28)17-35-11-9-33(19-35)15-25-5-3-23(30-25)13-21(1)29-22/h1-18,29-32H,19-20H2/b23-13-,24-14+,25-15+,26-16-,27-17+,28-18- |
| InChIKey | HSELOAXGHXPJJT-VOWPTCLVSA-N |
| XLogP | -0.58 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |