C23H24F3N5OS — CID 10299196
[4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone (PubChem CID 10299196) has the molecular formula C23H24F3N5OS and a molecular weight of 475.54 g/mol. Its IUPAC name is [4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone.
| Compound Name | [4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 10299196 |
| Molecular Formula | C23H24F3N5OS |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | [4-amino-2-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-1,3-thiazol-5-yl]-(3,4,5-trifluorophenyl)methanone |
| SMILES | CC(C)N1CCN(c2ccc(Nc3nc(N)c(C(=O)c4cc(F)c(F)c(F)c4)s3)cc2)CC1 |
| InChI | InChI=1S/C23H24F3N5OS/c1-13(2)30-7-9-31(10-8-30)16-5-3-15(4-6-16)28-23-29-22(27)21(33-23)20(32)14-11-17(24)19(26)18(25)12-14/h3-6,11-13H,7-10,27H2,1-2H3,(H,28,29) |
| InChIKey | DDKTUMPYBGZNOR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|