C9H21N3O2S2 — CID 102993369
2-[3-(dimethylamino)propyl-ethylsulfamoyl]ethanethioamide (PubChem CID 102993369) has the molecular formula C9H21N3O2S2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl-ethylsulfamoyl]ethanethioamide.
| Compound Name | 2-[3-(dimethylamino)propyl-ethylsulfamoyl]ethanethioamide |
|---|---|
| PubChem CID | 102993369 |
| Molecular Formula | C9H21N3O2S2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[3-(dimethylamino)propyl-ethylsulfamoyl]ethanethioamide |
| SMILES | CCN(CCCN(C)C)S(=O)(=O)CC(N)=S |
| InChI | InChI=1S/C9H21N3O2S2/c1-4-12(7-5-6-11(2)3)16(13,14)8-9(10)15/h4-8H2,1-3H3,(H2,10,15) |
| InChIKey | JEIREBPJUZEOEW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|