About ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate
ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate (PubChem CID 10299356) has the molecular formula C24H28F6O3
and a molecular weight of 478.47 g/mol. Its IUPAC name is ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate |
| PubChem CID | 10299356 |
| Molecular Formula | C24H28F6O3 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCOC(=O)CCCCCCC1C(=O)CCC1/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H28F6O3/c1-2-33-22(32)8-6-4-3-5-7-20-17(11-12-21(20)31)10-9-16-13-18(23(25,26)27)15-19(14-16)24(28,29)30/h9-10,13-15,17,20H,2-8,11-12H2,1H3/b10-9+ |
| InChIKey | KUSJFVWXLUFDFX-MDZDMXLPSA-N |
| XLogP | 7.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate?
The IUPAC name of ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate (CID 10299356) is ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate.
What is the SMILES notation for ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate?
The canonical SMILES for ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate is CCOC(=O)CCCCCCC1C(=O)CCC1/C=C/c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate?
The InChIKey is KUSJFVWXLUFDFX-MDZDMXLPSA-N. The full InChI is InChI=1S/C24H28F6O3/c1-2-33-22(32)8-6-4-3-5-7-20-17(11-12-21(20)31)10-9-16-13-18(23(25,26)27)15-19(14-16)24(28,29)30/h9-10,13-15,17,20H,2-8,11-12H2,1H3/b10-9+.
What are the key properties of ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate?
ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate has a molecular weight of 478.47 g/mol, XLogP of 7.24, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[2-[(E)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-5-oxocyclopentyl]heptanoate is sourced from PubChem (CID 10299356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).