C17H29N3 — CID 102993888
N'-ethyl-N,N-dimethyl-N'-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)propane-1,3-diamine (PubChem CID 102993888) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N'-ethyl-N,N-dimethyl-N'-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)propane-1,3-diamine.
| Compound Name | N'-ethyl-N,N-dimethyl-N'-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 102993888 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N'-ethyl-N,N-dimethyl-N'-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)propane-1,3-diamine |
| SMILES | CCN(CCCN(C)C)c1ccc2c(c1)CCC(C)N2 |
| InChI | InChI=1S/C17H29N3/c1-5-20(12-6-11-19(3)4)16-9-10-17-15(13-16)8-7-14(2)18-17/h9-10,13-14,18H,5-8,11-12H2,1-4H3 |
| InChIKey | VYBUYILOQJGZBI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|