C6H9N3O2 — CID 102993921
(3R,5S)-5-(1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol (PubChem CID 102993921) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is (3R,5S)-5-(1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-(1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 102993921 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (3R,5S)-5-(1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol |
| SMILES | O[C@H]1CN[C@H](c2ncno2)C1 |
| InChI | InChI=1S/C6H9N3O2/c10-4-1-5(7-2-4)6-8-3-9-11-6/h3-5,7,10H,1-2H2/t4-,5+/m1/s1 |
| InChIKey | XFJDDKJLNGNQTJ-UHNVWZDZSA-N |
| XLogP | -0.54 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |