C15H31N3 — CID 102994429
N'-[2-(azetidin-3-ylidene)propyl]-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102994429) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is N'-[2-(azetidin-3-ylidene)propyl]-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-[2-(azetidin-3-ylidene)propyl]-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102994429 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | N'-[2-(azetidin-3-ylidene)propyl]-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)CC(C)=C1CNC1 |
| InChI | InChI=1S/C15H31N3/c1-5-17(6-2)9-8-10-18(7-3)13-14(4)15-11-16-12-15/h16H,5-13H2,1-4H3 |
| InChIKey | DAERDGVNZYUEFA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|