C15H26N2O2S — CID 102994765
3-[[3-(diethylamino)propyl-ethylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 102994765) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-[[3-(diethylamino)propyl-ethylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[3-(diethylamino)propyl-ethylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102994765 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[[3-(diethylamino)propyl-ethylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | CCN(CC)CCCN(CC)Cc1ccsc1C(=O)O |
| InChI | InChI=1S/C15H26N2O2S/c1-4-16(5-2)9-7-10-17(6-3)12-13-8-11-20-14(13)15(18)19/h8,11H,4-7,9-10,12H2,1-3H3,(H,18,19) |
| InChIKey | ZZTRGMXGWMKDKM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |